C19H13NO4S — CID 163210764
5-[2-(2-hydroxyethyl)-1,3-dioxobenzo[de]isoquinolin-6-yl]thiophene-2-carbaldehyde (PubChem CID 163210764) has the molecular formula C19H13NO4S and a molecular weight of 351.38 g/mol. Its IUPAC name is 5-[2-(2-hydroxyethyl)-1,3-dioxobenzo[de]isoquinolin-6-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[2-(2-hydroxyethyl)-1,3-dioxobenzo[de]isoquinolin-6-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 163210764 |
| Molecular Formula | C19H13NO4S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 5-[2-(2-hydroxyethyl)-1,3-dioxobenzo[de]isoquinolin-6-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3c4c(cccc24)C(=O)N(CCO)C3=O)s1 |
| InChI | InChI=1S/C19H13NO4S/c21-9-8-20-18(23)14-3-1-2-13-12(16-7-4-11(10-22)25-16)5-6-15(17(13)14)19(20)24/h1-7,10,21H,8-9H2 |
| InChIKey | VYHFLNHPVHZSLW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|