C22H20N2O3 — CID 102447581
2-[2-(dimethylamino)ethyl]-6-phenoxybenzo[de]isoquinoline-1,3-dione (PubChem CID 102447581) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-6-phenoxybenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-(dimethylamino)ethyl]-6-phenoxybenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102447581 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-6-phenoxybenzo[de]isoquinoline-1,3-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3c(Oc4ccccc4)ccc(c23)C1=O |
| InChI | InChI=1S/C22H20N2O3/c1-23(2)13-14-24-21(25)17-10-6-9-16-19(27-15-7-4-3-5-8-15)12-11-18(20(16)17)22(24)26/h3-12H,13-14H2,1-2H3 |
| InChIKey | WTJUCHMNVLAXNM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|