C18H20N2O2S2 — CID 142469191
6-[methyl(3-sulfanylpropyl)amino]-2-(2-sulfanylethyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 142469191) has the molecular formula C18H20N2O2S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 6-[methyl(3-sulfanylpropyl)amino]-2-(2-sulfanylethyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[methyl(3-sulfanylpropyl)amino]-2-(2-sulfanylethyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 142469191 |
| Molecular Formula | C18H20N2O2S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 6-[methyl(3-sulfanylpropyl)amino]-2-(2-sulfanylethyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CN(CCCS)c1ccc2c3c(cccc13)C(=O)N(CCS)C2=O |
| InChI | InChI=1S/C18H20N2O2S2/c1-19(8-3-10-23)15-7-6-14-16-12(15)4-2-5-13(16)17(21)20(9-11-24)18(14)22/h2,4-7,23-24H,3,8-11H2,1H3 |
| InChIKey | OEKXASXBFCIHSS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|