C16H15N5O2 — CID 102499786
2-(2-azidoethyl)-6-(dimethylamino)benzo[de]isoquinoline-1,3-dione (PubChem CID 102499786) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-(2-azidoethyl)-6-(dimethylamino)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-azidoethyl)-6-(dimethylamino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102499786 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-(2-azidoethyl)-6-(dimethylamino)benzo[de]isoquinoline-1,3-dione |
| SMILES | CN(C)c1ccc2c3c(cccc13)C(=O)N(CCN=[N+]=[N-])C2=O |
| InChI | InChI=1S/C16H15N5O2/c1-20(2)13-7-6-12-14-10(13)4-3-5-11(14)15(22)21(16(12)23)9-8-18-19-17/h3-7H,8-9H2,1-2H3 |
| InChIKey | CQBDSKUNZOBRPG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|