C17H18N2O4 — CID 4891328
6-[bis(2-hydroxyethyl)amino]-2-methylbenzo[de]isoquinoline-1,3-dione (PubChem CID 4891328) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 6-[bis(2-hydroxyethyl)amino]-2-methylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[bis(2-hydroxyethyl)amino]-2-methylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4891328 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 6-[bis(2-hydroxyethyl)amino]-2-methylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CN1C(=O)c2cccc3c(N(CCO)CCO)ccc(c23)C1=O |
| InChI | InChI=1S/C17H18N2O4/c1-18-16(22)12-4-2-3-11-14(19(7-9-20)8-10-21)6-5-13(15(11)12)17(18)23/h2-6,20-21H,7-10H2,1H3 |
| InChIKey | DMTODFXKQOKBFT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|