C24H21N5O3 — CID 15332864
3-[N-(2-hydroxyethyl)-4-[(2-methyl-1,3-dioxobenzo[de]isoquinolin-6-yl)diazenyl]anilino]propanenitrile (PubChem CID 15332864) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is 3-[N-(2-hydroxyethyl)-4-[(2-methyl-1,3-dioxobenzo[de]isoquinolin-6-yl)diazenyl]anilino]propanenitrile.
| Compound Name | 3-[N-(2-hydroxyethyl)-4-[(2-methyl-1,3-dioxobenzo[de]isoquinolin-6-yl)diazenyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 15332864 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 3-[N-(2-hydroxyethyl)-4-[(2-methyl-1,3-dioxobenzo[de]isoquinolin-6-yl)diazenyl]anilino]propanenitrile |
| SMILES | CN1C(=O)c2cccc3c(/N=N/c4ccc(N(CCO)CCC#N)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C24H21N5O3/c1-28-23(31)19-5-2-4-18-21(11-10-20(22(18)19)24(28)32)27-26-16-6-8-17(9-7-16)29(14-15-30)13-3-12-25/h2,4-11,30H,3,13-15H2,1H3/b27-26+ |
| InChIKey | VXTIEUFLGBKBFX-CYYJNZCTSA-N |
| XLogP | 4.19 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|