C17H20N7+ — CID 22957477
3-[N-(2-cyanoethyl)-4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propanenitrile (PubChem CID 22957477) has the molecular formula C17H20N7+ and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-[N-(2-cyanoethyl)-4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propanenitrile.
| Compound Name | 3-[N-(2-cyanoethyl)-4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 22957477 |
| Molecular Formula | C17H20N7+ |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-[N-(2-cyanoethyl)-4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propanenitrile |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N(CCC#N)CCC#N)cc1 |
| InChI | InChI=1S/C17H20N7/c1-22-13-14-23(2)17(22)21-20-15-5-7-16(8-6-15)24(11-3-9-18)12-4-10-19/h5-8,13-14H,3-4,11-12H2,1-2H3/q+1 |
| InChIKey | DQDPEEHIWULZHH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|