C19H30Cl2N7+ — CID 163804345
N-chloro-N'-[4-(chloroamino)butyl]-N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine (PubChem CID 163804345) has the molecular formula C19H30Cl2N7+ and a molecular weight of 427.40 g/mol. Its IUPAC name is N-chloro-N'-[4-(chloroamino)butyl]-N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine.
| Compound Name | N-chloro-N'-[4-(chloroamino)butyl]-N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 163804345 |
| Molecular Formula | C19H30Cl2N7+ |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-chloro-N'-[4-(chloroamino)butyl]-N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N(CCCCNCl)CCCCNCl)cc1 |
| InChI | InChI=1S/C19H30Cl2N7/c1-26-15-16-27(2)19(26)25-24-17-7-9-18(10-8-17)28(13-5-3-11-22-20)14-6-4-12-23-21/h7-10,15-16,22-23H,3-6,11-14H2,1-2H3/q+1 |
| InChIKey | NHSBSTOBSRSVLU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|