C13H18ClN4O+ — CID 145155356
chloromethane;(1,3-dimethylimidazol-1-ium-2-yl)-(4-methoxyphenyl)diazene (PubChem CID 145155356) has the molecular formula C13H18ClN4O+ and a molecular weight of 281.77 g/mol. Its IUPAC name is chloromethane;(1,3-dimethylimidazol-1-ium-2-yl)-(4-methoxyphenyl)diazene.
| Compound Name | chloromethane;(1,3-dimethylimidazol-1-ium-2-yl)-(4-methoxyphenyl)diazene |
|---|---|
| PubChem CID | 145155356 |
| Molecular Formula | C13H18ClN4O+ |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | chloromethane;(1,3-dimethylimidazol-1-ium-2-yl)-(4-methoxyphenyl)diazene |
| SMILES | CCl.COc1ccc(/N=N/c2n(C)cc[n+]2C)cc1 |
| InChI | InChI=1S/C12H15N4O.CH3Cl/c1-15-8-9-16(2)12(15)14-13-10-4-6-11(17-3)7-5-10;1-2/h4-9H,1-3H3;1H3/q+1; |
| InChIKey | NNOMQRGYEAIBJX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|