C17H26I2N6 — CID 87739139
(1,3-dimethylimidazol-1-ium-2-yl)-[4-(4,4-dimethylpiperazin-4-ium-1-yl)phenyl]diazene diiodide (PubChem CID 87739139) has the molecular formula C17H26I2N6 and a molecular weight of 568.25 g/mol. Its IUPAC name is (1,3-dimethylimidazol-1-ium-2-yl)-[4-(4,4-dimethylpiperazin-4-ium-1-yl)phenyl]diazene diiodide.
| Compound Name | (1,3-dimethylimidazol-1-ium-2-yl)-[4-(4,4-dimethylpiperazin-4-ium-1-yl)phenyl]diazene diiodide |
|---|---|
| PubChem CID | 87739139 |
| Molecular Formula | C17H26I2N6 |
| Molecular Weight | 568.25 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | (1,3-dimethylimidazol-1-ium-2-yl)-[4-(4,4-dimethylpiperazin-4-ium-1-yl)phenyl]diazene diiodide |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N2CC[N+](C)(C)CC2)cc1.[I-].[I-] |
| InChI | InChI=1S/C17H26N6.2HI/c1-20-9-10-21(2)17(20)19-18-15-5-7-16(8-6-15)22-11-13-23(3,4)14-12-22;;/h5-10H,11-14H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | DWHIUYVJZWVFSY-UHFFFAOYSA-L |
| XLogP | -3.83 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.25 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|