C27H31N9+2 — CID 58978635
(1,3-dimethylimidazol-1-ium-2-yl)-[4-[4-[4-[(1-methylpyridin-1-ium-3-yl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene (PubChem CID 58978635) has the molecular formula C27H31N9+2 and a molecular weight of 481.61 g/mol. Its IUPAC name is (1,3-dimethylimidazol-1-ium-2-yl)-[4-[4-[4-[(1-methylpyridin-1-ium-3-yl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene.
| Compound Name | (1,3-dimethylimidazol-1-ium-2-yl)-[4-[4-[4-[(1-methylpyridin-1-ium-3-yl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene |
|---|---|
| PubChem CID | 58978635 |
| Molecular Formula | C27H31N9+2 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | (1,3-dimethylimidazol-1-ium-2-yl)-[4-[4-[4-[(1-methylpyridin-1-ium-3-yl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N2CCN(c3ccc(/N=N/c4ccc[n+](C)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H31N9/c1-32-14-4-5-24(21-32)30-28-22-6-10-25(11-7-22)35-17-19-36(20-18-35)26-12-8-23(9-13-26)29-31-27-33(2)15-16-34(27)3/h4-16,21H,17-20H2,1-3H3/q+2/b30-28+ |
| InChIKey | HDHCROLOFPZPGT-SJCQXOIGSA-N |
| XLogP | 4.83 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|