C24H30N12+2 — CID 121366623
(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)-[4-[4-[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene (PubChem CID 121366623) has the molecular formula C24H30N12+2 and a molecular weight of 486.59 g/mol. Its IUPAC name is (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)-[4-[4-[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene.
| Compound Name | (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)-[4-[4-[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene |
|---|---|
| PubChem CID | 121366623 |
| Molecular Formula | C24H30N12+2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)-[4-[4-[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene |
| SMILES | Cn1nc[n+](C)c1/N=N/c1ccc(N2CCN(c3ccc(/N=N/c4n(C)nc[n+]4C)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N12/c1-31-17-25-33(3)23(31)29-27-19-5-9-21(10-6-19)35-13-15-36(16-14-35)22-11-7-20(8-12-22)28-30-24-32(2)18-26-34(24)4/h5-12,17-18H,13-16H2,1-4H3/q+2 |
| InChIKey | LOZXFPUNAVAVDR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|