C17H26N7+ — CID 20741728
2-[4-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperazin-1-yl]ethanamine (PubChem CID 20741728) has the molecular formula C17H26N7+ and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-[4-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperazin-1-yl]ethanamine.
| Compound Name | 2-[4-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 20741728 |
| Molecular Formula | C17H26N7+ |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-[4-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]piperazin-1-yl]ethanamine |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(N2CCN(CCN)CC2)cc1 |
| InChI | InChI=1S/C17H26N7/c1-21-9-10-22(2)17(21)20-19-15-3-5-16(6-4-15)24-13-11-23(8-7-18)12-14-24/h3-6,9-10H,7-8,11-14,18H2,1-2H3/q+1 |
| InChIKey | BQVZTZAOXBXCBQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|