C16H23N5O5S — CID 145088074
(1,3-dimethylimidazol-1-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene;methyl sulfate (PubChem CID 145088074) has the molecular formula C16H23N5O5S and a molecular weight of 397.46 g/mol. Its IUPAC name is (1,3-dimethylimidazol-1-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene;methyl sulfate.
| Compound Name | (1,3-dimethylimidazol-1-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene;methyl sulfate |
|---|---|
| PubChem CID | 145088074 |
| Molecular Formula | C16H23N5O5S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (1,3-dimethylimidazol-1-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].Cn1cc[n+](C)c1/N=N/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H20N5O.CH4O4S/c1-18-7-8-19(2)15(18)17-16-13-3-5-14(6-4-13)20-9-11-21-12-10-20;1-5-6(2,3)4/h3-8H,9-12H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | ZIVLRLGWBPXALI-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 112.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|