C25H34ClN9O8S2 — CID 159321955
(4-chlorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline;methanesulfonoperoxoate (PubChem CID 159321955) has the molecular formula C25H34ClN9O8S2 and a molecular weight of 688.19 g/mol. Its IUPAC name is (4-chlorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline;methanesulfonoperoxoate.
| Compound Name | (4-chlorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline;methanesulfonoperoxoate |
|---|---|
| PubChem CID | 159321955 |
| Molecular Formula | C25H34ClN9O8S2 |
| Molecular Weight | 688.19 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | (4-chlorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline;methanesulfonoperoxoate |
| SMILES | CNc1ccc(/N=N/c2n(C)cc[n+]2C)cc1.CS(=O)(=O)O[O-].CS(=O)(=O)O[O-].Cn1cc[n+](C)c1/N=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15N5.C11H12ClN4.2CH4O4S/c1-13-10-4-6-11(7-5-10)14-15-12-16(2)8-9-17(12)3;1-15-7-8-16(2)11(15)14-13-10-5-3-9(12)4-6-10;2*1-6(3,4)5-2/h4-9H,1-3H3;3-8H,1-2H3;2*2H,1H3/q;+1;;/p-1 |
| InChIKey | LDWMILKMZRMJOG-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 211.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|