C15H24N6+2 — CID 143373718
2-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethyl-dimethylazanium (PubChem CID 143373718) has the molecular formula C15H24N6+2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethyl-dimethylazanium.
| Compound Name | 2-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 143373718 |
| Molecular Formula | C15H24N6+2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethyl-dimethylazanium |
| SMILES | Cn1cc[n+](C)c1/N=N/c1ccc(NCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C15H22N6/c1-19(2)10-9-16-13-5-7-14(8-6-13)17-18-15-20(3)11-12-21(15)4/h5-8,11-12H,9-10H2,1-4H3/p+2 |
| InChIKey | GDPNKCQBXMICEQ-UHFFFAOYSA-P |
| XLogP | 0.82 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|