C25H34N10+2 — CID 142193063
[[[4-[3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propylamino]phenyl]diazenyl]-(methylamino)methylidene]-ethenyl-methylazanium (PubChem CID 142193063) has the molecular formula C25H34N10+2 and a molecular weight of 474.62 g/mol. Its IUPAC name is [[[4-[3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propylamino]phenyl]diazenyl]-(methylamino)methylidene]-ethenyl-methylazanium.
| Compound Name | [[[4-[3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propylamino]phenyl]diazenyl]-(methylamino)methylidene]-ethenyl-methylazanium |
|---|---|
| PubChem CID | 142193063 |
| Molecular Formula | C25H34N10+2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [[[4-[3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propylamino]phenyl]diazenyl]-(methylamino)methylidene]-ethenyl-methylazanium |
| SMILES | C=C/[N+](C)=C(/N=N/c1ccc(NCCCNc2ccc(/N=N/c3n(C)cc[n+]3C)cc2)cc1)NC |
| InChI | InChI=1S/C25H32N10/c1-6-33(3)24(26-2)31-29-22-12-8-20(9-13-22)27-16-7-17-28-21-10-14-23(15-11-21)30-32-25-34(4)18-19-35(25)5/h6,8-15,18-19H,1,7,16-17H2,2-5H3,(H,26,27,31)/p+2 |
| InChIKey | AFNOYOWYELYMGB-UHFFFAOYSA-P |
| XLogP | 4.62 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|