C14H17ClN4OS — CID 145088077
(3-methyl-1,3-thiazol-3-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene chloride (PubChem CID 145088077) has the molecular formula C14H17ClN4OS and a molecular weight of 324.84 g/mol. Its IUPAC name is (3-methyl-1,3-thiazol-3-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene chloride.
| Compound Name | (3-methyl-1,3-thiazol-3-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene chloride |
|---|---|
| PubChem CID | 145088077 |
| Molecular Formula | C14H17ClN4OS |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (3-methyl-1,3-thiazol-3-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene chloride |
| SMILES | C[n+]1ccsc1/N=N/c1ccc(N2CCOCC2)cc1.[Cl-] |
| InChI | InChI=1S/C14H17N4OS.ClH/c1-17-8-11-20-14(17)16-15-12-2-4-13(5-3-12)18-6-9-19-10-7-18;/h2-5,8,11H,6-7,9-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | DEYUIPWKDYCSRX-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|