C20H22N5S+ — CID 59767419
4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-(4-pyrrolidin-1-ylphenyl)aniline (PubChem CID 59767419) has the molecular formula C20H22N5S+ and a molecular weight of 364.50 g/mol. Its IUPAC name is 4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-(4-pyrrolidin-1-ylphenyl)aniline.
| Compound Name | 4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-(4-pyrrolidin-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 59767419 |
| Molecular Formula | C20H22N5S+ |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-(4-pyrrolidin-1-ylphenyl)aniline |
| SMILES | C[n+]1ccsc1/N=N/c1ccc(Nc2ccc(N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C20H21N5S/c1-24-14-15-26-20(24)23-22-18-6-4-16(5-7-18)21-17-8-10-19(11-9-17)25-12-2-3-13-25/h4-11,14-15H,2-3,12-13H2,1H3/p+1 |
| InChIKey | WFFYGTDLVAMXQB-UHFFFAOYSA-O |
| XLogP | 5.33 |
| TPSA | 43.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|