C18H25N4S+ — CID 121366193
[4-(azepan-1-yl)phenyl]-(3-ethyl-5-methyl-1,3-thiazol-3-ium-2-yl)diazene (PubChem CID 121366193) has the molecular formula C18H25N4S+ and a molecular weight of 329.49 g/mol. Its IUPAC name is [4-(azepan-1-yl)phenyl]-(3-ethyl-5-methyl-1,3-thiazol-3-ium-2-yl)diazene.
| Compound Name | [4-(azepan-1-yl)phenyl]-(3-ethyl-5-methyl-1,3-thiazol-3-ium-2-yl)diazene |
|---|---|
| PubChem CID | 121366193 |
| Molecular Formula | C18H25N4S+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [4-(azepan-1-yl)phenyl]-(3-ethyl-5-methyl-1,3-thiazol-3-ium-2-yl)diazene |
| SMILES | CC[n+]1cc(C)sc1/N=N/c1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H25N4S/c1-3-21-14-15(2)23-18(21)20-19-16-8-10-17(11-9-16)22-12-6-4-5-7-13-22/h8-11,14H,3-7,12-13H2,1-2H3/q+1 |
| InChIKey | LWFFIVJNGKYYNQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|