C17H24N5S+ — CID 145088080
(1,3-diethylimidazol-1-ium-2-yl)-(4-thiomorpholin-4-ylphenyl)diazene (PubChem CID 145088080) has the molecular formula C17H24N5S+ and a molecular weight of 330.48 g/mol. Its IUPAC name is (1,3-diethylimidazol-1-ium-2-yl)-(4-thiomorpholin-4-ylphenyl)diazene.
| Compound Name | (1,3-diethylimidazol-1-ium-2-yl)-(4-thiomorpholin-4-ylphenyl)diazene |
|---|---|
| PubChem CID | 145088080 |
| Molecular Formula | C17H24N5S+ |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (1,3-diethylimidazol-1-ium-2-yl)-(4-thiomorpholin-4-ylphenyl)diazene |
| SMILES | CCn1cc[n+](CC)c1/N=N/c1ccc(N2CCSCC2)cc1 |
| InChI | InChI=1S/C17H24N5S/c1-3-20-9-10-21(4-2)17(20)19-18-15-5-7-16(8-6-15)22-11-13-23-14-12-22/h5-10H,3-4,11-14H2,1-2H3/q+1 |
| InChIKey | ASGNOJDHSORXKC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|