C32H44N10O2+2 — CID 130423899
(1,3-diethylimidazol-1-ium-2-yl)-[4-[4-[4-[(1,3-diethylimidazol-1-ium-2-yl)diazenyl]-3-methoxyphenyl]piperazin-1-yl]-2-methoxyphenyl]diazene (PubChem CID 130423899) has the molecular formula C32H44N10O2+2 and a molecular weight of 600.77 g/mol. Its IUPAC name is (1,3-diethylimidazol-1-ium-2-yl)-[4-[4-[4-[(1,3-diethylimidazol-1-ium-2-yl)diazenyl]-3-methoxyphenyl]piperazin-1-yl]-2-methoxyphenyl]diazene.
| Compound Name | (1,3-diethylimidazol-1-ium-2-yl)-[4-[4-[4-[(1,3-diethylimidazol-1-ium-2-yl)diazenyl]-3-methoxyphenyl]piperazin-1-yl]-2-methoxyphenyl]diazene |
|---|---|
| PubChem CID | 130423899 |
| Molecular Formula | C32H44N10O2+2 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | (1,3-diethylimidazol-1-ium-2-yl)-[4-[4-[4-[(1,3-diethylimidazol-1-ium-2-yl)diazenyl]-3-methoxyphenyl]piperazin-1-yl]-2-methoxyphenyl]diazene |
| SMILES | CCn1cc[n+](CC)c1/N=N/c1ccc(N2CCN(c3ccc(/N=N/c4n(CC)cc[n+]4CC)c(OC)c3)CC2)cc1OC |
| InChI | InChI=1S/C32H44N10O2/c1-7-37-15-16-38(8-2)31(37)35-33-27-13-11-25(23-29(27)43-5)41-19-21-42(22-20-41)26-12-14-28(30(24-26)44-6)34-36-32-39(9-3)17-18-40(32)10-4/h11-18,23-24H,7-10,19-22H2,1-6H3/q+2 |
| InChIKey | UTYQFFMXQPIIQK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 92.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|