C15H19N4OS+ — CID 121366200
(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene (PubChem CID 121366200) has the molecular formula C15H19N4OS+ and a molecular weight of 303.41 g/mol. Its IUPAC name is (3,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene.
| Compound Name | (3,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene |
|---|---|
| PubChem CID | 121366200 |
| Molecular Formula | C15H19N4OS+ |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (3,5-dimethyl-1,3-thiazol-3-ium-2-yl)-(4-morpholin-4-ylphenyl)diazene |
| SMILES | Cc1c[n+](C)c(/N=N/c2ccc(N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C15H19N4OS/c1-12-11-18(2)15(21-12)17-16-13-3-5-14(6-4-13)19-7-9-20-10-8-19/h3-6,11H,7-10H2,1-2H3/q+1 |
| InChIKey | DJNMULWXKYMLGF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|