C14H18N3OS+ — CID 91080593
(4-butoxyphenyl)-(3-methyl-1,3-thiazol-3-ium-2-yl)diazene (PubChem CID 91080593) has the molecular formula C14H18N3OS+ and a molecular weight of 276.39 g/mol. Its IUPAC name is (4-butoxyphenyl)-(3-methyl-1,3-thiazol-3-ium-2-yl)diazene.
| Compound Name | (4-butoxyphenyl)-(3-methyl-1,3-thiazol-3-ium-2-yl)diazene |
|---|---|
| PubChem CID | 91080593 |
| Molecular Formula | C14H18N3OS+ |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (4-butoxyphenyl)-(3-methyl-1,3-thiazol-3-ium-2-yl)diazene |
| SMILES | CCCCOc1ccc(/N=N/c2scc[n+]2C)cc1 |
| InChI | InChI=1S/C14H18N3OS/c1-3-4-10-18-13-7-5-12(6-8-13)15-16-14-17(2)9-11-19-14/h5-9,11H,3-4,10H2,1-2H3/q+1 |
| InChIKey | BFHMWDANRMUPDM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|