C27H34N8S2+2 — CID 121364421
N,N'-dimethyl-N,N'-bis[4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]pentane-1,5-diamine (PubChem CID 121364421) has the molecular formula C27H34N8S2+2 and a molecular weight of 534.76 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis[4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]pentane-1,5-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis[4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 121364421 |
| Molecular Formula | C27H34N8S2+2 |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis[4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]pentane-1,5-diamine |
| SMILES | CN(CCCCCN(C)c1ccc(/N=N/c2scc[n+]2C)cc1)c1ccc(/N=N/c2scc[n+]2C)cc1 |
| InChI | InChI=1S/C27H34N8S2/c1-32(24-12-8-22(9-13-24)28-30-26-34(3)18-20-36-26)16-6-5-7-17-33(2)25-14-10-23(11-15-25)29-31-27-35(4)19-21-37-27/h8-15,18-21H,5-7,16-17H2,1-4H3/q+2 |
| InChIKey | HWEAYHZOJSLERD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|