C29H40N8S2 — CID 160893105
carbanide;N,N'-dimethyl-N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine (PubChem CID 160893105) has the molecular formula C29H40N8S2 and a molecular weight of 564.83 g/mol. Its IUPAC name is carbanide;N,N'-dimethyl-N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine.
| Compound Name | carbanide;N,N'-dimethyl-N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 160893105 |
| Molecular Formula | C29H40N8S2 |
| Molecular Weight | 564.83 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | carbanide;N,N'-dimethyl-N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine |
| SMILES | Cc1cc(/N=N/c2scc[n+]2C)ccc1N(C)CCCN(C)c1ccc(/N=N/c2scc[n+]2C)cc1C.[CH3-].[CH3-] |
| InChI | InChI=1S/C27H34N8S2.2CH3/c1-20-18-22(28-30-26-34(5)14-16-36-26)8-10-24(20)32(3)12-7-13-33(4)25-11-9-23(19-21(25)2)29-31-27-35(6)15-17-37-27;;/h8-11,14-19H,7,12-13H2,1-6H3;2*1H3/q+2;2*-1 |
| InChIKey | SONLZYJOAXFOQB-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.83 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|