C27H34Cl2N8S2 — CID 130422108
N,N'-bis[4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]-N,N'-dimethylpropane-1,3-diamine dichloride (PubChem CID 130422108) has the molecular formula C27H34Cl2N8S2 and a molecular weight of 605.67 g/mol. Its IUPAC name is N,N'-bis[4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]-N,N'-dimethylpropane-1,3-diamine dichloride.
| Compound Name | N,N'-bis[4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]-N,N'-dimethylpropane-1,3-diamine dichloride |
|---|---|
| PubChem CID | 130422108 |
| Molecular Formula | C27H34Cl2N8S2 |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | N,N'-bis[4-[(3-ethyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]-N,N'-dimethylpropane-1,3-diamine dichloride |
| SMILES | CC[n+]1ccsc1/N=N/c1ccc(N(C)CCCN(C)c2ccc(/N=N/c3scc[n+]3CC)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H34N8S2.2ClH/c1-5-34-18-20-36-26(34)30-28-22-8-12-24(13-9-22)32(3)16-7-17-33(4)25-14-10-23(11-15-25)29-31-27-35(6-2)19-21-37-27;;/h8-15,18-21H,5-7,16-17H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | OCLSUOGTYHWWJJ-UHFFFAOYSA-L |
| XLogP | 1.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|