C30H42N8S2 — CID 160676728
carbanide;N,N'-dimethyl-N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine (PubChem CID 160676728) has the molecular formula C30H42N8S2 and a molecular weight of 578.86 g/mol. Its IUPAC name is carbanide;N,N'-dimethyl-N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine.
| Compound Name | carbanide;N,N'-dimethyl-N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 160676728 |
| Molecular Formula | C30H42N8S2 |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | carbanide;N,N'-dimethyl-N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine |
| SMILES | Cc1cc(/N=N/c2scc[n+]2C)ccc1N(C)CCCCN(C)c1ccc(/N=N/c2scc[n+]2C)cc1C.[CH3-].[CH3-] |
| InChI | InChI=1S/C28H36N8S2.2CH3/c1-21-19-23(29-31-27-35(5)15-17-37-27)9-11-25(21)33(3)13-7-8-14-34(4)26-12-10-24(20-22(26)2)30-32-28-36(6)16-18-38-28;;/h9-12,15-20H,7-8,13-14H2,1-6H3;2*1H3/q+2;2*-1 |
| InChIKey | RNPYMSQDXRIVLU-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|