C28H36Cl2N8O2S2 — CID 130422065
N-methyl-N-[2-[2-[2-[N-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline dichloride (PubChem CID 130422065) has the molecular formula C28H36Cl2N8O2S2 and a molecular weight of 651.69 g/mol. Its IUPAC name is N-methyl-N-[2-[2-[2-[N-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline dichloride.
| Compound Name | N-methyl-N-[2-[2-[2-[N-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline dichloride |
|---|---|
| PubChem CID | 130422065 |
| Molecular Formula | C28H36Cl2N8O2S2 |
| Molecular Weight | 651.69 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | N-methyl-N-[2-[2-[2-[N-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline dichloride |
| SMILES | CN(CCOCCOCCN(C)c1ccc(/N=N/c2scc[n+]2C)cc1)c1ccc(/N=N/c2scc[n+]2C)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C28H36N8O2S2.2ClH/c1-33(25-9-5-23(6-10-25)29-31-27-35(3)15-21-39-27)13-17-37-19-20-38-18-14-34(2)26-11-7-24(8-12-26)30-32-28-36(4)16-22-40-28;;/h5-12,15-16,21-22H,13-14,17-20H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | DLYITPUCZQODLB-UHFFFAOYSA-L |
| XLogP | -0.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.69 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|