C28H36Cl4N8OS2Zn — CID 130422079
N-ethyl-N-[2-[2-[N-ethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;tetrachlorozinc(2-) (PubChem CID 130422079) has the molecular formula C28H36Cl4N8OS2Zn and a molecular weight of 771.99 g/mol. Its IUPAC name is N-ethyl-N-[2-[2-[N-ethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;tetrachlorozinc(2-).
| Compound Name | N-ethyl-N-[2-[2-[N-ethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;tetrachlorozinc(2-) |
|---|---|
| PubChem CID | 130422079 |
| Molecular Formula | C28H36Cl4N8OS2Zn |
| Molecular Weight | 771.99 g/mol |
| Exact Mass | 768.05 |
| IUPAC Name | N-ethyl-N-[2-[2-[N-ethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethoxy]ethyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;tetrachlorozinc(2-) |
| SMILES | CCN(CCOCCN(CC)c1ccc(/N=N/c2scc[n+]2C)cc1)c1ccc(/N=N/c2scc[n+]2C)cc1.Cl[Zn-2](Cl)(Cl)Cl |
| InChI | InChI=1S/C28H36N8OS2.4ClH.Zn/c1-5-35(25-11-7-23(8-12-25)29-31-27-33(3)17-21-38-27)15-19-37-20-16-36(6-2)26-13-9-24(10-14-26)30-32-28-34(4)18-22-39-28;;;;;/h7-14,17-18,21-22H,5-6,15-16,19-20H2,1-4H3;4*1H;/q+2;;;;;+2/p-4 |
| InChIKey | ZLGBPYLJQUKYHW-UHFFFAOYSA-J |
| XLogP | 9.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.99 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|