C16H22N5OS+ — CID 102191514
N-[5-(diethylamino)-2-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]acetamide (PubChem CID 102191514) has the molecular formula C16H22N5OS+ and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[5-(diethylamino)-2-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]acetamide.
| Compound Name | N-[5-(diethylamino)-2-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 102191514 |
| Molecular Formula | C16H22N5OS+ |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[5-(diethylamino)-2-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(/N=N/c2scc[n+]2C)c(NC(C)=O)c1 |
| InChI | InChI=1S/C16H21N5OS/c1-5-21(6-2)13-7-8-14(15(11-13)17-12(3)22)18-19-16-20(4)9-10-23-16/h7-11H,5-6H2,1-4H3/p+1 |
| InChIKey | UBBXVZMDODVRLX-UHFFFAOYSA-O |
| XLogP | 3.79 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|