C14H21N4S+ — CID 159162434
methane;N,N,3-trimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline (PubChem CID 159162434) has the molecular formula C14H21N4S+ and a molecular weight of 277.42 g/mol. Its IUPAC name is methane;N,N,3-trimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline.
| Compound Name | methane;N,N,3-trimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 159162434 |
| Molecular Formula | C14H21N4S+ |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | methane;N,N,3-trimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
| SMILES | C.Cc1cc(N(C)C)ccc1/N=N/c1scc[n+]1C |
| InChI | InChI=1S/C13H17N4S.CH4/c1-10-9-11(16(2)3)5-6-12(10)14-15-13-17(4)7-8-18-13;/h5-9H,1-4H3;1H4/q+1; |
| InChIKey | KKQUHYPDKFOFJU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|