C21H25N4O2S+ — CID 59207782
N-[(3,4-dimethoxyphenyl)methyl]-N,3-dimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline (PubChem CID 59207782) has the molecular formula C21H25N4O2S+ and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N,3-dimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N,3-dimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 59207782 |
| Molecular Formula | C21H25N4O2S+ |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N,3-dimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
| SMILES | COc1ccc(CN(C)c2ccc(/N=N/c3scc[n+]3C)c(C)c2)cc1OC |
| InChI | InChI=1S/C21H25N4O2S/c1-15-12-17(7-8-18(15)22-23-21-24(2)10-11-28-21)25(3)14-16-6-9-19(26-4)20(13-16)27-5/h6-13H,14H2,1-5H3/q+1 |
| InChIKey | RWNPRIVGUHQUTR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|