C21H33N4OS+ — CID 59207762
N-ethyl-3-methyl-N-[2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline (PubChem CID 59207762) has the molecular formula C21H33N4OS+ and a molecular weight of 389.59 g/mol. Its IUPAC name is N-ethyl-3-methyl-N-[2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline.
| Compound Name | N-ethyl-3-methyl-N-[2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 59207762 |
| Molecular Formula | C21H33N4OS+ |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | N-ethyl-3-methyl-N-[2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
| SMILES | CCN(CC(C)COC(C)(C)C)c1ccc(/N=N/c2scc[n+]2C)c(C)c1 |
| InChI | InChI=1S/C21H33N4OS/c1-8-25(14-16(2)15-26-21(4,5)6)18-9-10-19(17(3)13-18)22-23-20-24(7)11-12-27-20/h9-13,16H,8,14-15H2,1-7H3/q+1 |
| InChIKey | UZQCHZDWUFKNEP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|