C11H13N4S+ — CID 90955743
3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline (PubChem CID 90955743) has the molecular formula C11H13N4S+ and a molecular weight of 233.32 g/mol. Its IUPAC name is 3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline.
| Compound Name | 3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 90955743 |
| Molecular Formula | C11H13N4S+ |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
| SMILES | Cc1cc(N)ccc1/N=N/c1scc[n+]1C |
| InChI | InChI=1S/C11H12N4S/c1-8-7-9(12)3-4-10(8)13-14-11-15(2)5-6-16-11/h3-7,12H,1-2H3/p+1 |
| InChIKey | NYLIBSDCGCWACY-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|