C22H25N7O — CID 59943104
N-[5-(diethylamino)-2-[(4,6-dimethyl-1,3,5-triazin-2-yl)diazenyl]phenyl]benzamide (PubChem CID 59943104) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[5-(diethylamino)-2-[(4,6-dimethyl-1,3,5-triazin-2-yl)diazenyl]phenyl]benzamide.
| Compound Name | N-[5-(diethylamino)-2-[(4,6-dimethyl-1,3,5-triazin-2-yl)diazenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 59943104 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[5-(diethylamino)-2-[(4,6-dimethyl-1,3,5-triazin-2-yl)diazenyl]phenyl]benzamide |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc(C)nc(C)n2)c(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H25N7O/c1-5-29(6-2)18-12-13-19(27-28-22-24-15(3)23-16(4)25-22)20(14-18)26-21(30)17-10-8-7-9-11-17/h7-14H,5-6H2,1-4H3,(H,26,30)/b28-27+ |
| InChIKey | WMCFWEUFFSGCBV-BYYHNAKLSA-N |
| XLogP | 5.00 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|