C20H26N6OS — CID 89099976
N-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-5-(diethylamino)phenyl]pentanamide (PubChem CID 89099976) has the molecular formula C20H26N6OS and a molecular weight of 398.54 g/mol. Its IUPAC name is N-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-5-(diethylamino)phenyl]pentanamide.
| Compound Name | N-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-5-(diethylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 89099976 |
| Molecular Formula | C20H26N6OS |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-5-(diethylamino)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cc(N(CC)CC)ccc1/N=N/c1snc(C)c1C#N |
| InChI | InChI=1S/C20H26N6OS/c1-5-8-9-19(27)22-18-12-15(26(6-2)7-3)10-11-17(18)23-24-20-16(13-21)14(4)25-28-20/h10-12H,5-9H2,1-4H3,(H,22,27)/b24-23+ |
| InChIKey | QXRUVRQEPSYVQZ-WCWDXBQESA-N |
| XLogP | 5.71 |
| TPSA | 93.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|