C17H19N5O2S — CID 154510979
2-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-N-ethylanilino]ethyl acetate (PubChem CID 154510979) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-N-ethylanilino]ethyl acetate.
| Compound Name | 2-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-N-ethylanilino]ethyl acetate |
|---|---|
| PubChem CID | 154510979 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-N-ethylanilino]ethyl acetate |
| SMILES | CCN(CCOC(C)=O)c1ccccc1/N=N/c1snc(C)c1C#N |
| InChI | InChI=1S/C17H19N5O2S/c1-4-22(9-10-24-13(3)23)16-8-6-5-7-15(16)19-20-17-14(11-18)12(2)21-25-17/h5-8H,4,9-10H2,1-3H3/b20-19+ |
| InChIKey | BAKQOAFSJPHAHI-FMQUCBEESA-N |
| XLogP | 4.13 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|