C27H28N6O5S — CID 157121538
N-[5-amino-2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]phenyl]acetamide;2-(2-methylprop-2-enoyloxy)ethyl 4-methylbenzoate (PubChem CID 157121538) has the molecular formula C27H28N6O5S and a molecular weight of 548.63 g/mol. Its IUPAC name is N-[5-amino-2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]phenyl]acetamide;2-(2-methylprop-2-enoyloxy)ethyl 4-methylbenzoate.
| Compound Name | N-[5-amino-2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]phenyl]acetamide;2-(2-methylprop-2-enoyloxy)ethyl 4-methylbenzoate |
|---|---|
| PubChem CID | 157121538 |
| Molecular Formula | C27H28N6O5S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | N-[5-amino-2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]phenyl]acetamide;2-(2-methylprop-2-enoyloxy)ethyl 4-methylbenzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccc(C)cc1.CC(=O)Nc1cc(N)ccc1/N=N/c1snc(C)c1C#N |
| InChI | InChI=1S/C14H16O4.C13H12N6OS/c1-10(2)13(15)17-8-9-18-14(16)12-6-4-11(3)5-7-12;1-7-10(6-14)13(21-19-7)18-17-11-4-3-9(15)5-12(11)16-8(2)20/h4-7H,1,8-9H2,2-3H3;3-5H,15H2,1-2H3,(H,16,20)/b;18-17+ |
| InChIKey | AIAKROATJBIOOC-XRISSZCKSA-N |
| XLogP | 5.55 |
| TPSA | 169.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|