C25H28N6O5S — CID 137315473
3-[4-[(5-amino-3-cyanothiophen-2-yl)diazenyl]-N-ethyl-3-(3-prop-2-enoyloxypropanoylamino)anilino]propyl prop-2-enoate (PubChem CID 137315473) has the molecular formula C25H28N6O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is 3-[4-[(5-amino-3-cyanothiophen-2-yl)diazenyl]-N-ethyl-3-(3-prop-2-enoyloxypropanoylamino)anilino]propyl prop-2-enoate.
| Compound Name | 3-[4-[(5-amino-3-cyanothiophen-2-yl)diazenyl]-N-ethyl-3-(3-prop-2-enoyloxypropanoylamino)anilino]propyl prop-2-enoate |
|---|---|
| PubChem CID | 137315473 |
| Molecular Formula | C25H28N6O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 3-[4-[(5-amino-3-cyanothiophen-2-yl)diazenyl]-N-ethyl-3-(3-prop-2-enoyloxypropanoylamino)anilino]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCN(CC)c1ccc(/N=N/c2sc(N)cc2C#N)c(NC(=O)CCOC(=O)C=C)c1 |
| InChI | InChI=1S/C25H28N6O5S/c1-4-23(33)35-12-7-11-31(6-3)18-8-9-19(29-30-25-17(16-26)14-21(27)37-25)20(15-18)28-22(32)10-13-36-24(34)5-2/h4-5,8-9,14-15H,1-2,6-7,10-13,27H2,3H3,(H,28,32)/b30-29+ |
| InChIKey | KUXUJBCCHNZQQB-QVIHXGFCSA-N |
| XLogP | 4.62 |
| TPSA | 159.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|