C17H25N6O+ — CID 69223338
N-[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-(diethylamino)phenyl]acetamide (PubChem CID 69223338) has the molecular formula C17H25N6O+ and a molecular weight of 329.43 g/mol. Its IUPAC name is N-[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-(diethylamino)phenyl]acetamide.
| Compound Name | N-[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 69223338 |
| Molecular Formula | C17H25N6O+ |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(/N=C2/C=N[N+](CC)=C2N)c(NC(C)=O)c1 |
| InChI | InChI=1S/C17H24N6O/c1-5-22(6-2)13-8-9-14(15(10-13)20-12(4)24)21-16-11-19-23(7-3)17(16)18/h8-11H,5-7H2,1-4H3,(H2,18,19,20,24)/p+1 |
| InChIKey | YMLZCJQDAFDLBQ-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|