C18H20N7O+ — CID 69221427
[2-[(5-amino-1-phenylpyrazol-1-ium-4-ylidene)amino]-5-(dimethylamino)phenyl]urea (PubChem CID 69221427) has the molecular formula C18H20N7O+ and a molecular weight of 350.41 g/mol. Its IUPAC name is [2-[(5-amino-1-phenylpyrazol-1-ium-4-ylidene)amino]-5-(dimethylamino)phenyl]urea.
| Compound Name | [2-[(5-amino-1-phenylpyrazol-1-ium-4-ylidene)amino]-5-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 69221427 |
| Molecular Formula | C18H20N7O+ |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [2-[(5-amino-1-phenylpyrazol-1-ium-4-ylidene)amino]-5-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1ccc(/N=C2\C=N[N+](c3ccccc3)=C2N)c(NC(N)=O)c1 |
| InChI | InChI=1S/C18H19N7O/c1-24(2)13-8-9-14(15(10-13)23-18(20)26)22-16-11-21-25(17(16)19)12-6-4-3-5-7-12/h3-11H,1-2H3,(H4,19,20,21,23,26)/p+1 |
| InChIKey | GKNYBQPKFKFOGL-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|