C23H27N6O2+ — CID 69224677
N-[2-[[5-amino-1-[(4-methylphenyl)methyl]pyrazol-1-ium-4-ylidene]amino]-5-morpholin-4-ylphenyl]acetamide (PubChem CID 69224677) has the molecular formula C23H27N6O2+ and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[2-[[5-amino-1-[(4-methylphenyl)methyl]pyrazol-1-ium-4-ylidene]amino]-5-morpholin-4-ylphenyl]acetamide.
| Compound Name | N-[2-[[5-amino-1-[(4-methylphenyl)methyl]pyrazol-1-ium-4-ylidene]amino]-5-morpholin-4-ylphenyl]acetamide |
|---|---|
| PubChem CID | 69224677 |
| Molecular Formula | C23H27N6O2+ |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[2-[[5-amino-1-[(4-methylphenyl)methyl]pyrazol-1-ium-4-ylidene]amino]-5-morpholin-4-ylphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(N2CCOCC2)ccc1/N=C1\C=N[N+](Cc2ccc(C)cc2)=C1N |
| InChI | InChI=1S/C23H26N6O2/c1-16-3-5-18(6-4-16)15-29-23(24)22(14-25-29)27-20-8-7-19(13-21(20)26-17(2)30)28-9-11-31-12-10-28/h3-8,13-14H,9-12,15H2,1-2H3,(H2,24,25,26,30)/p+1 |
| InChIKey | QAQIZKPKMXTZMU-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|