C20H22N7O2+ — CID 69223456
[2-[(5-amino-1-phenylpyrazol-1-ium-4-ylidene)amino]-5-morpholin-4-ylphenyl]urea (PubChem CID 69223456) has the molecular formula C20H22N7O2+ and a molecular weight of 392.44 g/mol. Its IUPAC name is [2-[(5-amino-1-phenylpyrazol-1-ium-4-ylidene)amino]-5-morpholin-4-ylphenyl]urea.
| Compound Name | [2-[(5-amino-1-phenylpyrazol-1-ium-4-ylidene)amino]-5-morpholin-4-ylphenyl]urea |
|---|---|
| PubChem CID | 69223456 |
| Molecular Formula | C20H22N7O2+ |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [2-[(5-amino-1-phenylpyrazol-1-ium-4-ylidene)amino]-5-morpholin-4-ylphenyl]urea |
| SMILES | NC(=O)Nc1cc(N2CCOCC2)ccc1/N=C1\C=N[N+](c2ccccc2)=C1N |
| InChI | InChI=1S/C20H21N7O2/c21-19-18(13-23-27(19)14-4-2-1-3-5-14)24-16-7-6-15(12-17(16)25-20(22)28)26-8-10-29-11-9-26/h1-7,12-13H,8-11H2,(H4,21,22,23,25,28)/p+1 |
| InChIKey | VLADHRMGDKTZGA-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|