C21H24FN3O3 — CID 4824008
N-(2,4-dimorpholin-4-ylphenyl)-3-fluorobenzamide (PubChem CID 4824008) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)-3-fluorobenzamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 4824008 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)-3-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1N1CCOCC1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H24FN3O3/c22-17-3-1-2-16(14-17)21(26)23-19-5-4-18(24-6-10-27-11-7-24)15-20(19)25-8-12-28-13-9-25/h1-5,14-15H,6-13H2,(H,23,26) |
| InChIKey | NEVZNVGEXSATLN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |