C23H30N4O3 — CID 26072175
3-(dimethylamino)-N-(2,4-dimorpholin-4-ylphenyl)benzamide (PubChem CID 26072175) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-(dimethylamino)-N-(2,4-dimorpholin-4-ylphenyl)benzamide.
| Compound Name | 3-(dimethylamino)-N-(2,4-dimorpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 26072175 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 3-(dimethylamino)-N-(2,4-dimorpholin-4-ylphenyl)benzamide |
| SMILES | CN(C)c1cccc(C(=O)Nc2ccc(N3CCOCC3)cc2N2CCOCC2)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-25(2)19-5-3-4-18(16-19)23(28)24-21-7-6-20(26-8-12-29-13-9-26)17-22(21)27-10-14-30-15-11-27/h3-7,16-17H,8-15H2,1-2H3,(H,24,28) |
| InChIKey | VGEODDYPLGKUFH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |