C27H30N4O5 — CID 24653710
N-[5-[(2,4-dimorpholin-4-ylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide (PubChem CID 24653710) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[5-[(2,4-dimorpholin-4-ylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-[(2,4-dimorpholin-4-ylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24653710 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[5-[(2,4-dimorpholin-4-ylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2N2CCOCC2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C27H30N4O5/c1-19-4-5-20(17-23(19)29-27(33)25-3-2-12-36-25)26(32)28-22-7-6-21(30-8-13-34-14-9-30)18-24(22)31-10-15-35-16-11-31/h2-7,12,17-18H,8-11,13-16H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | ONFUAAYPFUSBHP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |