C18H25N6O+ — CID 69225226
N-[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-piperidin-1-ylphenyl]acetamide (PubChem CID 69225226) has the molecular formula C18H25N6O+ and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-piperidin-1-ylphenyl]acetamide.
| Compound Name | N-[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-piperidin-1-ylphenyl]acetamide |
|---|---|
| PubChem CID | 69225226 |
| Molecular Formula | C18H25N6O+ |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[2-[(5-amino-1-ethylpyrazol-1-ium-4-ylidene)amino]-5-piperidin-1-ylphenyl]acetamide |
| SMILES | CC[N+]1=C(N)/C(=N\c2ccc(N3CCCCC3)cc2NC(C)=O)C=N1 |
| InChI | InChI=1S/C18H24N6O/c1-3-24-18(19)17(12-20-24)22-15-8-7-14(11-16(15)21-13(2)25)23-9-5-4-6-10-23/h7-8,11-12H,3-6,9-10H2,1-2H3,(H2,19,20,21,25)/p+1 |
| InChIKey | GTOHGIQJHWVIKM-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|