C18H27N6O2S+ — CID 69224967
N-[2-[(5-amino-3-methyl-1-propan-2-ylpyrazol-1-ium-4-ylidene)amino]-5-pyrrolidin-1-ylphenyl]methanesulfonamide (PubChem CID 69224967) has the molecular formula C18H27N6O2S+ and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[2-[(5-amino-3-methyl-1-propan-2-ylpyrazol-1-ium-4-ylidene)amino]-5-pyrrolidin-1-ylphenyl]methanesulfonamide.
| Compound Name | N-[2-[(5-amino-3-methyl-1-propan-2-ylpyrazol-1-ium-4-ylidene)amino]-5-pyrrolidin-1-ylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 69224967 |
| Molecular Formula | C18H27N6O2S+ |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[2-[(5-amino-3-methyl-1-propan-2-ylpyrazol-1-ium-4-ylidene)amino]-5-pyrrolidin-1-ylphenyl]methanesulfonamide |
| SMILES | CC1=N[N+](C(C)C)=C(N)/C1=N/c1ccc(N2CCCC2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C18H26N6O2S/c1-12(2)24-18(19)17(13(3)21-24)20-15-8-7-14(23-9-5-6-10-23)11-16(15)22-27(4,25)26/h7-8,11-12H,5-6,9-10H2,1-4H3,(H2,19,21,22)/p+1 |
| InChIKey | ZXKLVOLUVBVVKM-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|