C18H25N6O3+ — CID 69334822
N-[2-[[5-amino-1-(2-hydroxyethyl)pyrazol-1-ium-4-ylidene]amino]-5-(3-hydroxypiperidin-1-yl)phenyl]acetamide (PubChem CID 69334822) has the molecular formula C18H25N6O3+ and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[2-[[5-amino-1-(2-hydroxyethyl)pyrazol-1-ium-4-ylidene]amino]-5-(3-hydroxypiperidin-1-yl)phenyl]acetamide.
| Compound Name | N-[2-[[5-amino-1-(2-hydroxyethyl)pyrazol-1-ium-4-ylidene]amino]-5-(3-hydroxypiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 69334822 |
| Molecular Formula | C18H25N6O3+ |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[2-[[5-amino-1-(2-hydroxyethyl)pyrazol-1-ium-4-ylidene]amino]-5-(3-hydroxypiperidin-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(N2CCCC(O)C2)ccc1/N=C1\C=N[N+](CCO)=C1N |
| InChI | InChI=1S/C18H24N6O3/c1-12(26)21-16-9-13(23-6-2-3-14(27)11-23)4-5-15(16)22-17-10-20-24(7-8-25)18(17)19/h4-5,9-10,14,25,27H,2-3,6-8,11H2,1H3,(H2,19,20,21,26)/p+1 |
| InChIKey | ZPGLNIVCMNQFPM-UHFFFAOYSA-O |
| XLogP | 0.04 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|